C20H17N5O3 — CID 135608078
3-hydroxy-2-[(4-methoxyphenyl)methyl]-4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]isoquinolin-1-one (PubChem CID 135608078) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 3-hydroxy-2-[(4-methoxyphenyl)methyl]-4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]isoquinolin-1-one.
| Compound Name | 3-hydroxy-2-[(4-methoxyphenyl)methyl]-4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135608078 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-hydroxy-2-[(4-methoxyphenyl)methyl]-4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]isoquinolin-1-one |
| SMILES | COc1ccc(Cn2c(O)c(/C=N/c3ncn[nH]3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C20H17N5O3/c1-28-14-8-6-13(7-9-14)11-25-18(26)16-5-3-2-4-15(16)17(19(25)27)10-21-20-22-12-23-24-20/h2-10,12,27H,11H2,1H3,(H,22,23,24)/b21-10+ |
| InChIKey | ZMOCACZZPDWVDZ-UFFVCSGVSA-N |
| XLogP | 2.63 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|