C19H12F3N5O2 — CID 135591202
3-hydroxy-4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 135591202) has the molecular formula C19H12F3N5O2 and a molecular weight of 399.33 g/mol. Its IUPAC name is 3-hydroxy-4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 3-hydroxy-4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135591202 |
| Molecular Formula | C19H12F3N5O2 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 3-hydroxy-4-[(E)-1H-1,2,4-triazol-5-yliminomethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/c2ncn[nH]2)c(O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12F3N5O2/c20-19(21,22)11-4-3-5-12(8-11)27-16(28)14-7-2-1-6-13(14)15(17(27)29)9-23-18-24-10-25-26-18/h1-10,29H,(H,24,25,26)/b23-9+ |
| InChIKey | DMZUMRXBCBJMLR-NUGSKGIGSA-N |
| XLogP | 3.58 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|