C21H17F3N2O4S — CID 4889344
4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxy-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 4889344) has the molecular formula C21H17F3N2O4S and a molecular weight of 450.44 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxy-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxy-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 4889344 |
| Molecular Formula | C21H17F3N2O4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxy-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/C2CCS(=O)(=O)C2)c(O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17F3N2O4S/c22-21(23,24)13-4-3-5-15(10-13)26-19(27)17-7-2-1-6-16(17)18(20(26)28)11-25-14-8-9-31(29,30)12-14/h1-7,10-11,14,28H,8-9,12H2/b25-11+ |
| InChIKey | XVFVDBMLUWEIGL-OPEKNORGSA-N |
| XLogP | 3.32 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|