C24H15BrF3N3O3 — CID 135466019
3-bromo-N-[(E)-[3-hydroxy-1-oxo-2-[3-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]benzamide (PubChem CID 135466019) has the molecular formula C24H15BrF3N3O3 and a molecular weight of 530.30 g/mol. Its IUPAC name is 3-bromo-N-[(E)-[3-hydroxy-1-oxo-2-[3-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]benzamide.
| Compound Name | 3-bromo-N-[(E)-[3-hydroxy-1-oxo-2-[3-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135466019 |
| Molecular Formula | C24H15BrF3N3O3 |
| Molecular Weight | 530.30 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | 3-bromo-N-[(E)-[3-hydroxy-1-oxo-2-[3-(trifluoromethyl)phenyl]isoquinolin-4-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1c(O)n(-c2cccc(C(F)(F)F)c2)c(=O)c2ccccc12)c1cccc(Br)c1 |
| InChI | InChI=1S/C24H15BrF3N3O3/c25-16-7-3-5-14(11-16)21(32)30-29-13-20-18-9-1-2-10-19(18)22(33)31(23(20)34)17-8-4-6-15(12-17)24(26,27)28/h1-13,34H,(H,30,32)/b29-13+ |
| InChIKey | GFTWIOGTSHNKCL-VFLNYLIXSA-N |
| XLogP | 5.24 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.30 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|