C21H15F3N6O3 — CID 135591178
3-hydroxy-4-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 135591178) has the molecular formula C21H15F3N6O3 and a molecular weight of 456.38 g/mol. Its IUPAC name is 3-hydroxy-4-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 3-hydroxy-4-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135591178 |
| Molecular Formula | C21H15F3N6O3 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 3-hydroxy-4-[(E)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | Cc1nnc(N/N=C/c2c(O)n(-c3cccc(C(F)(F)F)c3)c(=O)c3ccccc23)[nH]c1=O |
| InChI | InChI=1S/C21H15F3N6O3/c1-11-17(31)26-20(29-27-11)28-25-10-16-14-7-2-3-8-15(14)18(32)30(19(16)33)13-6-4-5-12(9-13)21(22,23)24/h2-10,33H,1H3,(H2,26,28,29,31)/b25-10+ |
| InChIKey | KESDHKVISGVGHW-KIBLKLHPSA-N |
| XLogP | 2.95 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|