C16H17N7O2 — CID 135784809
3-[(2Z)-2-[(2,4-dimethyl-5-oxo-1-phenylpyrazol-3-yl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135784809) has the molecular formula C16H17N7O2 and a molecular weight of 339.36 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2,4-dimethyl-5-oxo-1-phenylpyrazol-3-yl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2Z)-2-[(2,4-dimethyl-5-oxo-1-phenylpyrazol-3-yl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135784809 |
| Molecular Formula | C16H17N7O2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-[(2Z)-2-[(2,4-dimethyl-5-oxo-1-phenylpyrazol-3-yl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(N/N=C\c2c(C)c(=O)n(-c3ccccc3)n2C)[nH]c1=O |
| InChI | InChI=1S/C16H17N7O2/c1-10-13(9-17-20-16-18-14(24)11(2)19-21-16)22(3)23(15(10)25)12-7-5-4-6-8-12/h4-9H,1-3H3,(H2,18,20,21,24)/b17-9- |
| InChIKey | ORCXYYSUAHYEEG-MFOYZWKCSA-N |
| XLogP | 0.72 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|