C9H9N5OS — CID 135539351
6-methyl-3-[2-(thiophen-2-ylmethylidene)hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135539351) has the molecular formula C9H9N5OS and a molecular weight of 235.27 g/mol. Its IUPAC name is 6-methyl-3-[2-(thiophen-2-ylmethylidene)hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-[2-(thiophen-2-ylmethylidene)hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135539351 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 6-methyl-3-[2-(thiophen-2-ylmethylidene)hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(NN=Cc2cccs2)[nH]c1=O |
| InChI | InChI=1S/C9H9N5OS/c1-6-8(15)11-9(14-12-6)13-10-5-7-3-2-4-16-7/h2-5H,1H3,(H2,11,13,14,15) |
| InChIKey | IVHOVBJOZNAFTI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|