C17H19N7O — CID 135847806
3-[(2Z)-2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135847806) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is 3-[(2Z)-2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2Z)-2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135847806 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 3-[(2Z)-2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1/C=N\Nc1nnc(C)c(=O)[nH]1 |
| InChI | InChI=1S/C17H19N7O/c1-11-15(9-18-21-17-19-16(25)12(2)20-22-17)13(3)24(23-11)10-14-7-5-4-6-8-14/h4-9H,10H2,1-3H3,(H2,19,21,22,25)/b18-9- |
| InChIKey | XDCVFJHNBQJSHB-NVMNQCDNSA-N |
| XLogP | 1.78 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|