C13H18ClN7O — CID 135784924
3-[(2Z)-2-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135784924) has the molecular formula C13H18ClN7O and a molecular weight of 323.79 g/mol. Its IUPAC name is 3-[(2Z)-2-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2Z)-2-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135784924 |
| Molecular Formula | C13H18ClN7O |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-[(2Z)-2-[[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1/C=N\Nc1nnc(C)c(=O)[nH]1 |
| InChI | InChI=1S/C13H18ClN7O/c1-7(2)6-21-11(14)10(8(3)20-21)5-15-18-13-16-12(22)9(4)17-19-13/h5,7H,6H2,1-4H3,(H2,16,18,19,22)/b15-5- |
| InChIKey | UEDCGGQNGDXVEC-WCSRMQSCSA-N |
| XLogP | 1.73 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|