C20H23ClN6O2 — CID 9462905
N-[(Z)-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide (PubChem CID 9462905) has the molecular formula C20H23ClN6O2 and a molecular weight of 414.90 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(Z)-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9462905 |
| Molecular Formula | C20H23ClN6O2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[(Z)-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCn1nc(C(=O)N/N=C\c2c(C)nn(CC(C)C)c2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C20H23ClN6O2/c1-5-26-20(29)15-9-7-6-8-14(15)17(25-26)19(28)23-22-10-16-13(4)24-27(18(16)21)11-12(2)3/h6-10,12H,5,11H2,1-4H3,(H,23,28)/b22-10- |
| InChIKey | SBTNQFKTQLVLGC-YVNNLAQVSA-N |
| XLogP | 2.99 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|