C23H25ClN4O2 — CID 8518126
N-[(Z)-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]-4-(phenoxymethyl)benzamide (PubChem CID 8518126) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]-4-(phenoxymethyl)benzamide.
| Compound Name | N-[(Z)-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]-4-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 8518126 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[(Z)-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methylideneamino]-4-(phenoxymethyl)benzamide |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1/C=N\NC(=O)c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C23H25ClN4O2/c1-16(2)14-28-22(24)21(17(3)27-28)13-25-26-23(29)19-11-9-18(10-12-19)15-30-20-7-5-4-6-8-20/h4-13,16H,14-15H2,1-3H3,(H,26,29)/b25-13- |
| InChIKey | IRMBNVSPYDFJEO-MXAYSNPKSA-N |
| XLogP | 4.84 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|