C23H24Cl2N4O3 — CID 46804651
N-[(E)-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-methoxy-4-propan-2-yloxybenzamide (PubChem CID 46804651) has the molecular formula C23H24Cl2N4O3 and a molecular weight of 475.38 g/mol. Its IUPAC name is N-[(E)-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-methoxy-4-propan-2-yloxybenzamide.
| Compound Name | N-[(E)-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-methoxy-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 46804651 |
| Molecular Formula | C23H24Cl2N4O3 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-[(E)-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-methoxy-4-propan-2-yloxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2c(C)nn(Cc3ccc(Cl)cc3)c2Cl)ccc1OC(C)C |
| InChI | InChI=1S/C23H24Cl2N4O3/c1-14(2)32-20-10-7-17(11-21(20)31-4)23(30)27-26-12-19-15(3)28-29(22(19)25)13-16-5-8-18(24)9-6-16/h5-12,14H,13H2,1-4H3,(H,27,30)/b26-12+ |
| InChIKey | KQNXLDDQKUSXLE-RPPGKUMJSA-N |
| XLogP | 5.11 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|