C20H17ClN4O3 — CID 2654622
N-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 2654622) has the molecular formula C20H17ClN4O3 and a molecular weight of 396.83 g/mol. Its IUPAC name is N-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 2654622 |
| Molecular Formula | C20H17ClN4O3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1C=NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H17ClN4O3/c1-13-16(19(21)25(24-13)11-14-5-3-2-4-6-14)10-22-23-20(26)15-7-8-17-18(9-15)28-12-27-17/h2-10H,11-12H2,1H3,(H,23,26) |
| InChIKey | UGCRUAGCSVTWMV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|