C20H19ClN4O — CID 9174864
N-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-chlorobenzamide (PubChem CID 9174864) has the molecular formula C20H19ClN4O and a molecular weight of 366.85 g/mol. Its IUPAC name is N-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-chlorobenzamide.
| Compound Name | N-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-chlorobenzamide |
|---|---|
| PubChem CID | 9174864 |
| Molecular Formula | C20H19ClN4O |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-chlorobenzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1/C=N\NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19ClN4O/c1-14-19(12-22-23-20(26)17-9-6-10-18(21)11-17)15(2)25(24-14)13-16-7-4-3-5-8-16/h3-12H,13H2,1-2H3,(H,23,26)/b22-12- |
| InChIKey | LELVRBKQYGAENE-UUYOSTAYSA-N |
| XLogP | 3.97 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|