C26H23ClFN5O4S — CID 2543732
N-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 2543732) has the molecular formula C26H23ClFN5O4S and a molecular weight of 556.02 g/mol. Its IUPAC name is N-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2543732 |
| Molecular Formula | C26H23ClFN5O4S |
| Molecular Weight | 556.02 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | N-[[5-chloro-1-[(4-fluorophenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NN=Cc2c(C)nn(Cc3ccc(F)cc3)c2Cl)c1 |
| InChI | InChI=1S/C26H23ClFN5O4S/c1-17-22(25(27)33(31-17)16-18-10-12-20(28)13-11-18)15-29-30-26(34)19-6-5-7-21(14-19)38(35,36)32-23-8-3-4-9-24(23)37-2/h3-15,32H,16H2,1-2H3,(H,30,34) |
| InChIKey | YFODSLCSELKJKM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|