C25H17ClN4O2 — CID 42995647
N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 42995647) has the molecular formula C25H17ClN4O2 and a molecular weight of 440.89 g/mol. Its IUPAC name is N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42995647 |
| Molecular Formula | C25H17ClN4O2 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)N/N=C/c2c3ccccc3c(Cl)c3ccccc23)c2ccccc2c1=O |
| InChI | InChI=1S/C25H17ClN4O2/c1-30-25(32)20-13-7-6-12-19(20)23(29-30)24(31)28-27-14-21-15-8-2-4-10-17(15)22(26)18-11-5-3-9-16(18)21/h2-14H,1H3,(H,28,31)/b27-14+ |
| InChIKey | UYYSRMQZGPEBBF-MZJWZYIUSA-N |
| XLogP | 4.66 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|