C23H18N4O2 — CID 9095305
N-(benzhydrylideneamino)-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 9095305) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-(benzhydrylideneamino)-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-(benzhydrylideneamino)-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9095305 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(benzhydrylideneamino)-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)NN=C(c2ccccc2)c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H18N4O2/c1-27-23(29)19-15-9-8-14-18(19)21(26-27)22(28)25-24-20(16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-15H,1H3,(H,25,28) |
| InChIKey | FCVZDBQTVJHJDE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|