C23H26N5O3+ — CID 9231942
3-methyl-N-[(Z)-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]-4-oxophthalazine-1-carboxamide (PubChem CID 9231942) has the molecular formula C23H26N5O3+ and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-methyl-N-[(Z)-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9231942 |
| Molecular Formula | C23H26N5O3+ |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-methyl-N-[(Z)-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]-4-oxophthalazine-1-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nn(C)c(=O)c2ccccc12)[C@@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C23H25N5O3/c1-16(21(17-8-4-3-5-9-17)28-12-14-31-15-13-28)24-25-22(29)20-18-10-6-7-11-19(18)23(30)27(2)26-20/h3-11,21H,12-15H2,1-2H3,(H,25,29)/p+1/b24-16-/t21-/m0/s1 |
| InChIKey | YROZZAMUWDNZIV-MVUTXWCHSA-O |
| XLogP | 0.70 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|