C20H24N3O3+ — CID 9212466
2-hydroxy-N-[(Z)-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]benzamide (PubChem CID 9212466) has the molecular formula C20H24N3O3+ and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]benzamide.
| Compound Name | 2-hydroxy-N-[(Z)-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 9212466 |
| Molecular Formula | C20H24N3O3+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-hydroxy-N-[(Z)-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccccc1O)[C@@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H23N3O3/c1-15(21-22-20(25)17-9-5-6-10-18(17)24)19(16-7-3-2-4-8-16)23-11-13-26-14-12-23/h2-10,19,24H,11-14H2,1H3,(H,22,25)/p+1/b21-15-/t19-/m0/s1 |
| InChIKey | IIUHRSCFWYNAEC-SLOMDMAXSA-O |
| XLogP | 1.15 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|