C19H25N4O2S+ — CID 9231790
2-(2-methyl-1,3-thiazol-4-yl)-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]acetamide (PubChem CID 9231790) has the molecular formula C19H25N4O2S+ and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]acetamide.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 9231790 |
| Molecular Formula | C19H25N4O2S+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]acetamide |
| SMILES | C/C(=N/NC(=O)Cc1csc(C)n1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H24N4O2S/c1-14(21-22-18(24)12-17-13-26-15(2)20-17)19(16-6-4-3-5-7-16)23-8-10-25-11-9-23/h3-7,13,19H,8-12H2,1-2H3,(H,22,24)/p+1/b21-14-/t19-/m1/s1 |
| InChIKey | LFYWNEYZSLBOLJ-BWCLHNGZSA-O |
| XLogP | 1.14 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|