C19H23N4O2+ — CID 9211513
N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]pyridine-3-carboxamide (PubChem CID 9211513) has the molecular formula C19H23N4O2+ and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9211513 |
| Molecular Formula | C19H23N4O2+ |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]pyridine-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cccnc1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H22N4O2/c1-15(21-22-19(24)17-8-5-9-20-14-17)18(16-6-3-2-4-7-16)23-10-12-25-13-11-23/h2-9,14,18H,10-13H2,1H3,(H,22,24)/p+1/b21-15-/t18-/m1/s1 |
| InChIKey | YWMABQMVRBXJBI-AFDUHFSSSA-O |
| XLogP | 0.84 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|