C17H23N6O2+ — CID 135722580
6-methyl-3-[(2Z)-2-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135722580) has the molecular formula C17H23N6O2+ and a molecular weight of 343.41 g/mol. Its IUPAC name is 6-methyl-3-[(2Z)-2-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-[(2Z)-2-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135722580 |
| Molecular Formula | C17H23N6O2+ |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 6-methyl-3-[(2Z)-2-[(1R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | C/C(=N/Nc1nnc(C)c(=O)[nH]1)[C@@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H22N6O2/c1-12(19-21-17-18-16(24)13(2)20-22-17)15(14-6-4-3-5-7-14)23-8-10-25-11-9-23/h3-7,15H,8-11H2,1-2H3,(H2,18,21,22,24)/p+1/b19-12-/t15-/m0/s1 |
| InChIKey | YJZZOPBPHQJPFB-CCRNYGKSSA-O |
| XLogP | -0.08 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|