C18H25N6O3+ — CID 135784883
3-[(2Z)-2-[1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135784883) has the molecular formula C18H25N6O3+ and a molecular weight of 373.44 g/mol. Its IUPAC name is 3-[(2Z)-2-[1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2Z)-2-[1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135784883 |
| Molecular Formula | C18H25N6O3+ |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 3-[(2Z)-2-[1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(/C(C)=N\Nc2nnc(C)c(=O)[nH]2)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C18H24N6O3/c1-12(20-22-18-19-17(25)13(2)21-23-18)14-4-5-16(26-3)15(10-14)11-24-6-8-27-9-7-24/h4-5,10H,6-9,11H2,1-3H3,(H2,19,22,23,25)/p+1/b20-12- |
| InChIKey | XJASEXDDPPIXTK-NDENLUEZSA-O |
| XLogP | -0.27 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|