C20H25N4O3+ — CID 9015637
N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]pyridine-2-carboxamide (PubChem CID 9015637) has the molecular formula C20H25N4O3+ and a molecular weight of 369.45 g/mol. Its IUPAC name is N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 9015637 |
| Molecular Formula | C20H25N4O3+ |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]pyridine-2-carboxamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)c2ccccn2)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H24N4O3/c1-15(22-23-20(25)18-5-3-4-8-21-18)16-6-7-19(26-2)17(13-16)14-24-9-11-27-12-10-24/h3-8,13H,9-12,14H2,1-2H3,(H,23,25)/p+1/b22-15- |
| InChIKey | AZZWDYCVYWAQPZ-JCMHNJIXSA-O |
| XLogP | 0.66 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|