C15H23N4O3+ — CID 9017280
[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]urea (PubChem CID 9017280) has the molecular formula C15H23N4O3+ and a molecular weight of 307.37 g/mol. Its IUPAC name is [(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]urea.
| Compound Name | [(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]urea |
|---|---|
| PubChem CID | 9017280 |
| Molecular Formula | C15H23N4O3+ |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]urea |
| SMILES | COc1ccc(/C(C)=N\NC(N)=O)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H22N4O3/c1-11(17-18-15(16)20)12-3-4-14(21-2)13(9-12)10-19-5-7-22-8-6-19/h3-4,9H,5-8,10H2,1-2H3,(H3,16,18,20)/p+1/b17-11- |
| InChIKey | MSPQFYVKSMYVCG-BOPFTXTBSA-O |
| XLogP | -0.50 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|