C20H31N4O3S+ — CID 9410063
1-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 9410063) has the molecular formula C20H31N4O3S+ and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 9410063 |
| Molecular Formula | C20H31N4O3S+ |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 1-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | COc1ccc(/C(C)=N\NC(=S)NC[C@@H]2CCCO2)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H30N4O3S/c1-15(22-23-20(28)21-13-18-4-3-9-27-18)16-5-6-19(25-2)17(12-16)14-24-7-10-26-11-8-24/h5-6,12,18H,3-4,7-11,13-14H2,1-2H3,(H2,21,23,28)/p+1/b22-15-/t18-/m0/s1 |
| InChIKey | HABBUCUMPXBLEG-CEZZIEKDSA-O |
| XLogP | 0.48 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|