C19H31N4O2S+ — CID 135571795
diethyl-[[2-hydroxy-5-[(E)-C-methyl-N-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]carbonimidoyl]phenyl]methyl]azanium (PubChem CID 135571795) has the molecular formula C19H31N4O2S+ and a molecular weight of 379.55 g/mol. Its IUPAC name is diethyl-[[2-hydroxy-5-[(E)-C-methyl-N-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]carbonimidoyl]phenyl]methyl]azanium.
| Compound Name | diethyl-[[2-hydroxy-5-[(E)-C-methyl-N-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]carbonimidoyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 135571795 |
| Molecular Formula | C19H31N4O2S+ |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | diethyl-[[2-hydroxy-5-[(E)-C-methyl-N-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]carbonimidoyl]phenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N/NC(=S)NC[C@H]2CCCO2)ccc1O |
| InChI | InChI=1S/C19H30N4O2S/c1-4-23(5-2)13-16-11-15(8-9-18(16)24)14(3)21-22-19(26)20-12-17-7-6-10-25-17/h8-9,11,17,24H,4-7,10,12-13H2,1-3H3,(H2,20,22,26)/p+1/b21-14+/t17-/m1/s1 |
| InChIKey | UQGBSPGOQDBOSN-AQRZYSDFSA-O |
| XLogP | 1.18 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|