C20H25N5O2S2 — CID 41294285
1-[(Z)-1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 41294285) has the molecular formula C20H25N5O2S2 and a molecular weight of 431.59 g/mol. Its IUPAC name is 1-[(Z)-1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(Z)-1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 41294285 |
| Molecular Formula | C20H25N5O2S2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 1-[(Z)-1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | COc1ccc(/C(C)=N\NC(=S)NC[C@H]2CCCO2)cc1CSc1ncccn1 |
| InChI | InChI=1S/C20H25N5O2S2/c1-14(24-25-19(28)23-12-17-5-3-10-27-17)15-6-7-18(26-2)16(11-15)13-29-20-21-8-4-9-22-20/h4,6-9,11,17H,3,5,10,12-13H2,1-2H3,(H2,23,25,28)/b24-14-/t17-/m1/s1 |
| InChIKey | VLSSHWLIKZANKK-SNNLMFDCSA-N |
| XLogP | 3.14 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|