C21H28FN4OS+ — CID 135776889
diethyl-[[5-[(E)-N-[(4-fluorophenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl]azanium (PubChem CID 135776889) has the molecular formula C21H28FN4OS+ and a molecular weight of 403.55 g/mol. Its IUPAC name is diethyl-[[5-[(E)-N-[(4-fluorophenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl]azanium.
| Compound Name | diethyl-[[5-[(E)-N-[(4-fluorophenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl]azanium |
|---|---|
| PubChem CID | 135776889 |
| Molecular Formula | C21H28FN4OS+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | diethyl-[[5-[(E)-N-[(4-fluorophenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]-2-hydroxyphenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N/NC(=S)NCc2ccc(F)cc2)ccc1O |
| InChI | InChI=1S/C21H27FN4OS/c1-4-26(5-2)14-18-12-17(8-11-20(18)27)15(3)24-25-21(28)23-13-16-6-9-19(22)10-7-16/h6-12,27H,4-5,13-14H2,1-3H3,(H2,23,25,28)/p+1/b24-15+ |
| InChIKey | VZDKMICTBOETTL-BUVRLJJBSA-O |
| XLogP | 2.34 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|