C14H20FN3S — CID 8870385
1-[(4-fluorophenyl)methyl]-3-[(Z)-2-methylpentan-3-ylideneamino]thiourea (PubChem CID 8870385) has the molecular formula C14H20FN3S and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[(Z)-2-methylpentan-3-ylideneamino]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[(Z)-2-methylpentan-3-ylideneamino]thiourea |
|---|---|
| PubChem CID | 8870385 |
| Molecular Formula | C14H20FN3S |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[(Z)-2-methylpentan-3-ylideneamino]thiourea |
| SMILES | CC/C(=N/NC(=S)NCc1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C14H20FN3S/c1-4-13(10(2)3)17-18-14(19)16-9-11-5-7-12(15)8-6-11/h5-8,10H,4,9H2,1-3H3,(H2,16,18,19)/b17-13- |
| InChIKey | RXJOFVPUVQMCBB-LGMDPLHJSA-N |
| XLogP | 3.21 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|