C15H14FN3O2S2 — CID 8871389
5-[(Z)-N-[(4-fluorophenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]thiophene-2-carboxylic acid (PubChem CID 8871389) has the molecular formula C15H14FN3O2S2 and a molecular weight of 351.43 g/mol. Its IUPAC name is 5-[(Z)-N-[(4-fluorophenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(Z)-N-[(4-fluorophenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 8871389 |
| Molecular Formula | C15H14FN3O2S2 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 5-[(Z)-N-[(4-fluorophenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]thiophene-2-carboxylic acid |
| SMILES | C/C(=N/NC(=S)NCc1ccc(F)cc1)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C15H14FN3O2S2/c1-9(12-6-7-13(23-12)14(20)21)18-19-15(22)17-8-10-2-4-11(16)5-3-10/h2-7H,8H2,1H3,(H,20,21)(H2,17,19,22)/b18-9- |
| InChIKey | ISYDXZAWYWOKAI-NVMNQCDNSA-N |
| XLogP | 2.97 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|