C16H19FN4S — CID 135776894
1-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 135776894) has the molecular formula C16H19FN4S and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 135776894 |
| Molecular Formula | C16H19FN4S |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-[(E)-1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylideneamino]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | C/C(=N\NC(=S)NCc1ccc(F)cc1)c1c(C)c[nH]c1C |
| InChI | InChI=1S/C16H19FN4S/c1-10-8-18-11(2)15(10)12(3)20-21-16(22)19-9-13-4-6-14(17)7-5-13/h4-8,18H,9H2,1-3H3,(H2,19,21,22)/b20-12+ |
| InChIKey | ONUGFKFOOKSEBQ-UDWIEESQSA-N |
| XLogP | 3.16 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|