C17H16FN3O2S — CID 8870557
1-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 8870557) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8870557 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | C/C(=N/NC(=S)NCc1ccc(F)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16FN3O2S/c1-11(13-4-7-15-16(8-13)23-10-22-15)20-21-17(24)19-9-12-2-5-14(18)6-3-12/h2-8H,9-10H2,1H3,(H2,19,21,24)/b20-11- |
| InChIKey | YUJMCQGPKSWBPV-JAIQZWGSSA-N |
| XLogP | 2.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|