C14H22N3O2+ — CID 7441652
(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylidenehydrazine (PubChem CID 7441652) has the molecular formula C14H22N3O2+ and a molecular weight of 264.35 g/mol. Its IUPAC name is (Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylidenehydrazine.
| Compound Name | (Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylidenehydrazine |
|---|---|
| PubChem CID | 7441652 |
| Molecular Formula | C14H22N3O2+ |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylidenehydrazine |
| SMILES | COc1ccc(/C(C)=N\N)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C14H21N3O2/c1-11(16-15)12-3-4-14(18-2)13(9-12)10-17-5-7-19-8-6-17/h3-4,9H,5-8,10,15H2,1-2H3/p+1/b16-11- |
| InChIKey | QIUPAFKUHBGZPL-WJDWOHSUSA-O |
| XLogP | -0.21 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|