C23H26ClN4O2+ — CID 9076847
7-chloro-N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]quinolin-4-amine (PubChem CID 9076847) has the molecular formula C23H26ClN4O2+ and a molecular weight of 425.94 g/mol. Its IUPAC name is 7-chloro-N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]quinolin-4-amine.
| Compound Name | 7-chloro-N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]quinolin-4-amine |
|---|---|
| PubChem CID | 9076847 |
| Molecular Formula | C23H26ClN4O2+ |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 7-chloro-N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]quinolin-4-amine |
| SMILES | COc1ccc(/C(C)=N\Nc2ccnc3cc(Cl)ccc23)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C23H25ClN4O2/c1-16(26-27-21-7-8-25-22-14-19(24)4-5-20(21)22)17-3-6-23(29-2)18(13-17)15-28-9-11-30-12-10-28/h3-8,13-14H,9-12,15H2,1-2H3,(H,25,27)/p+1/b26-16- |
| InChIKey | YWQDSJZYHWBINS-QQXSKIMKSA-O |
| XLogP | 3.15 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|