C20H27N4O3S+ — CID 9029766
N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 9029766) has the molecular formula C20H27N4O3S+ and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9029766 |
| Molecular Formula | C20H27N4O3S+ |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)Cc2nc(C)cs2)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H26N4O3S/c1-14-13-28-20(21-14)11-19(25)23-22-15(2)16-4-5-18(26-3)17(10-16)12-24-6-8-27-9-7-24/h4-5,10,13H,6-9,11-12H2,1-3H3,(H,23,25)/p+1/b22-15- |
| InChIKey | YFLBXGNPEHUHPJ-JCMHNJIXSA-O |
| XLogP | 0.96 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|