C24H32N3O4+ — CID 9316017
2-(2,5-dimethylphenoxy)-N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]acetamide (PubChem CID 9316017) has the molecular formula C24H32N3O4+ and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 9316017 |
| Molecular Formula | C24H32N3O4+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]acetamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)COc2cc(C)ccc2C)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C24H31N3O4/c1-17-5-6-18(2)23(13-17)31-16-24(28)26-25-19(3)20-7-8-22(29-4)21(14-20)15-27-9-11-30-12-10-27/h5-8,13-14H,9-12,15-16H2,1-4H3,(H,26,28)/p+1/b25-19- |
| InChIKey | HGFXHSIGAJMBON-PLRJNAJWSA-O |
| XLogP | 1.65 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|