C22H27ClN3O3+ — CID 9315310
2-(2-chlorophenoxy)-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]acetamide (PubChem CID 9315310) has the molecular formula C22H27ClN3O3+ and a molecular weight of 416.93 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 9315310 |
| Molecular Formula | C22H27ClN3O3+ |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]acetamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)COc2ccccc2Cl)cc1C[NH+]1CCCC1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-16(24-25-22(27)15-29-21-8-4-3-7-19(21)23)17-9-10-20(28-2)18(13-17)14-26-11-5-6-12-26/h3-4,7-10,13H,5-6,11-12,14-15H2,1-2H3,(H,25,27)/p+1/b24-16- |
| InChIKey | FAPLITBUHYXNCD-JLPGSUDCSA-O |
| XLogP | 2.45 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|