C20H25FN3O+ — CID 9076321
4-fluoro-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]aniline (PubChem CID 9076321) has the molecular formula C20H25FN3O+ and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-fluoro-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]aniline.
| Compound Name | 4-fluoro-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]aniline |
|---|---|
| PubChem CID | 9076321 |
| Molecular Formula | C20H25FN3O+ |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 4-fluoro-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]aniline |
| SMILES | COc1ccc(/C(C)=N\Nc2ccc(F)cc2)cc1C[NH+]1CCCC1 |
| InChI | InChI=1S/C20H24FN3O/c1-15(22-23-19-8-6-18(21)7-9-19)16-5-10-20(25-2)17(13-16)14-24-11-3-4-12-24/h5-10,13,23H,3-4,11-12,14H2,1-2H3/p+1/b22-15- |
| InChIKey | HKRDUDNEUMYCCO-JCMHNJIXSA-O |
| XLogP | 2.85 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|