C20H25FN3O+ — CID 135588243
4-[(E)-N-(4-fluoroanilino)-C-methylcarbonimidoyl]-2-(piperidin-1-ium-1-ylmethyl)phenol (PubChem CID 135588243) has the molecular formula C20H25FN3O+ and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-[(E)-N-(4-fluoroanilino)-C-methylcarbonimidoyl]-2-(piperidin-1-ium-1-ylmethyl)phenol.
| Compound Name | 4-[(E)-N-(4-fluoroanilino)-C-methylcarbonimidoyl]-2-(piperidin-1-ium-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 135588243 |
| Molecular Formula | C20H25FN3O+ |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 4-[(E)-N-(4-fluoroanilino)-C-methylcarbonimidoyl]-2-(piperidin-1-ium-1-ylmethyl)phenol |
| SMILES | C/C(=N\Nc1ccc(F)cc1)c1ccc(O)c(C[NH+]2CCCCC2)c1 |
| InChI | InChI=1S/C20H24FN3O/c1-15(22-23-19-8-6-18(21)7-9-19)16-5-10-20(25)17(13-16)14-24-11-3-2-4-12-24/h5-10,13,23,25H,2-4,11-12,14H2,1H3/p+1/b22-15+ |
| InChIKey | VFQHJPQSKIYYEI-PXLXIMEGSA-O |
| XLogP | 2.94 |
| TPSA | 49.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|