C21H27FN3O+ — CID 9076317
4-fluoro-N-[(Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]aniline (PubChem CID 9076317) has the molecular formula C21H27FN3O+ and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-fluoro-N-[(Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]aniline.
| Compound Name | 4-fluoro-N-[(Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]aniline |
|---|---|
| PubChem CID | 9076317 |
| Molecular Formula | C21H27FN3O+ |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 4-fluoro-N-[(Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]aniline |
| SMILES | COc1ccc(/C(C)=N\Nc2ccc(F)cc2)cc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C21H26FN3O/c1-16(23-24-20-9-7-19(22)8-10-20)17-6-11-21(26-2)18(14-17)15-25-12-4-3-5-13-25/h6-11,14,24H,3-5,12-13,15H2,1-2H3/p+1/b23-16- |
| InChIKey | BILSAHLUGWMXAO-KQWNVCNZSA-O |
| XLogP | 3.24 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|