C23H28N5OS+ — CID 9409316
N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 9409316) has the molecular formula C23H28N5OS+ and a molecular weight of 422.58 g/mol. Its IUPAC name is N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 9409316 |
| Molecular Formula | C23H28N5OS+ |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | COc1ccc(/C(C)=N\Nc2ncnc3sc4c(c23)CCC4)cc1C[NH+]1CCCC1 |
| InChI | InChI=1S/C23H27N5OS/c1-15(16-8-9-19(29-2)17(12-16)13-28-10-3-4-11-28)26-27-22-21-18-6-5-7-20(18)30-23(21)25-14-24-22/h8-9,12,14H,3-7,10-11,13H2,1-2H3,(H,24,25,27)/p+1/b26-15- |
| InChIKey | IBYYUENNYIYVGN-YSMPRRRNSA-O |
| XLogP | 3.20 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|