C22H28N5OS+ — CID 135571785
diethyl-[[2-hydroxy-5-[(E)-C-methyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)carbonimidoyl]phenyl]methyl]azanium (PubChem CID 135571785) has the molecular formula C22H28N5OS+ and a molecular weight of 410.57 g/mol. Its IUPAC name is diethyl-[[2-hydroxy-5-[(E)-C-methyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)carbonimidoyl]phenyl]methyl]azanium.
| Compound Name | diethyl-[[2-hydroxy-5-[(E)-C-methyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)carbonimidoyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 135571785 |
| Molecular Formula | C22H28N5OS+ |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | diethyl-[[2-hydroxy-5-[(E)-C-methyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)carbonimidoyl]phenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N/Nc2ncnc3sc4c(c23)CCC4)ccc1O |
| InChI | InChI=1S/C22H27N5OS/c1-4-27(5-2)12-16-11-15(9-10-18(16)28)14(3)25-26-21-20-17-7-6-8-19(17)29-22(20)24-13-23-21/h9-11,13,28H,4-8,12H2,1-3H3,(H,23,24,26)/p+1/b25-14+ |
| InChIKey | DSWZIJZHFVIWND-AFUMVMLFSA-O |
| XLogP | 3.15 |
| TPSA | 74.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|