C24H30N4S — CID 7474617
(6S)-6-(2-methylbutan-2-yl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 7474617) has the molecular formula C24H30N4S and a molecular weight of 406.60 g/mol. Its IUPAC name is (6S)-6-(2-methylbutan-2-yl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | (6S)-6-(2-methylbutan-2-yl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 7474617 |
| Molecular Formula | C24H30N4S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | (6S)-6-(2-methylbutan-2-yl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCC(C)(C)[C@H]1CCc2sc3ncnc(N/N=C(\C)c4ccc(C)cc4)c3c2C1 |
| InChI | InChI=1S/C24H30N4S/c1-6-24(4,5)18-11-12-20-19(13-18)21-22(25-14-26-23(21)29-20)28-27-16(3)17-9-7-15(2)8-10-17/h7-10,14,18H,6,11-13H2,1-5H3,(H,25,26,28)/b27-16+/t18-/m0/s1 |
| InChIKey | ZLRKEESVQBLHOE-NLTKLDOMSA-N |
| XLogP | 6.38 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|