C21H25N5S — CID 7430901
(6R)-6-(2-methylbutan-2-yl)-N-[(E)-pyridin-2-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 7430901) has the molecular formula C21H25N5S and a molecular weight of 379.53 g/mol. Its IUPAC name is (6R)-6-(2-methylbutan-2-yl)-N-[(E)-pyridin-2-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | (6R)-6-(2-methylbutan-2-yl)-N-[(E)-pyridin-2-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 7430901 |
| Molecular Formula | C21H25N5S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (6R)-6-(2-methylbutan-2-yl)-N-[(E)-pyridin-2-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCC(C)(C)[C@@H]1CCc2sc3ncnc(N/N=C/c4ccccn4)c3c2C1 |
| InChI | InChI=1S/C21H25N5S/c1-4-21(2,3)14-8-9-17-16(11-14)18-19(23-13-24-20(18)27-17)26-25-12-15-7-5-6-10-22-15/h5-7,10,12-14H,4,8-9,11H2,1-3H3,(H,23,24,26)/b25-12+/t14-/m1/s1 |
| InChIKey | GDKLXWFRLSVLEU-KWRYHKOTSA-N |
| XLogP | 5.07 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|