C25H32N4S — CID 92879123
(6S)-6-(2-methylbutan-2-yl)-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 92879123) has the molecular formula C25H32N4S and a molecular weight of 420.63 g/mol. Its IUPAC name is (6S)-6-(2-methylbutan-2-yl)-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | (6S)-6-(2-methylbutan-2-yl)-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 92879123 |
| Molecular Formula | C25H32N4S |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (6S)-6-(2-methylbutan-2-yl)-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCC(C)(C)[C@H]1CCc2sc3ncnc(N/N=C/c4ccc(C(C)C)cc4)c3c2C1 |
| InChI | InChI=1S/C25H32N4S/c1-6-25(4,5)19-11-12-21-20(13-19)22-23(26-15-27-24(22)30-21)29-28-14-17-7-9-18(10-8-17)16(2)3/h7-10,14-16,19H,6,11-13H2,1-5H3,(H,26,27,29)/b28-14+/t19-/m0/s1 |
| InChIKey | BLIMJBXVGYMQEP-FUSDPXDGSA-N |
| XLogP | 6.80 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|