C23H27FN4S — CID 170922646
1-(4-fluorophenyl)ethyl-[6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]diazene (PubChem CID 170922646) has the molecular formula C23H27FN4S and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-(4-fluorophenyl)ethyl-[6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]diazene.
| Compound Name | 1-(4-fluorophenyl)ethyl-[6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]diazene |
|---|---|
| PubChem CID | 170922646 |
| Molecular Formula | C23H27FN4S |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-(4-fluorophenyl)ethyl-[6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]diazene |
| SMILES | CCC(C)(C)C1CCc2sc3ncnc(/N=N/C(C)c4ccc(F)cc4)c3c2C1 |
| InChI | InChI=1S/C23H27FN4S/c1-5-23(3,4)16-8-11-19-18(12-16)20-21(25-13-26-22(20)29-19)28-27-14(2)15-6-9-17(24)10-7-15/h6-7,9-10,13-14,16H,5,8,11-12H2,1-4H3/b28-27+ |
| InChIKey | XTIYNSMHFCBXTB-BYYHNAKLSA-N |
| XLogP | 7.22 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|