C23H24BrN5OS — CID 136748761
5-bromo-3-[[(6S)-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]diazenyl]-1H-indol-2-ol (PubChem CID 136748761) has the molecular formula C23H24BrN5OS and a molecular weight of 498.45 g/mol. Its IUPAC name is 5-bromo-3-[[(6S)-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]diazenyl]-1H-indol-2-ol.
| Compound Name | 5-bromo-3-[[(6S)-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 136748761 |
| Molecular Formula | C23H24BrN5OS |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 5-bromo-3-[[(6S)-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]diazenyl]-1H-indol-2-ol |
| SMILES | CCC(C)(C)[C@H]1CCc2sc3ncnc(/N=N/c4c(O)[nH]c5ccc(Br)cc45)c3c2C1 |
| InChI | InChI=1S/C23H24BrN5OS/c1-4-23(2,3)12-5-8-17-15(9-12)18-20(25-11-26-22(18)31-17)29-28-19-14-10-13(24)6-7-16(14)27-21(19)30/h6-7,10-12,27,30H,4-5,8-9H2,1-3H3/b29-28+/t12-/m0/s1 |
| InChIKey | ZTQZWBLZSAKIJL-IJQOLWARSA-N |
| XLogP | 7.60 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|