C15H14N4OS — CID 9409427
N-[(Z)-1-(furan-2-yl)ethylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 9409427) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)ethylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[(Z)-1-(furan-2-yl)ethylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 9409427 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)ethylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | C/C(=N/Nc1ncnc2sc3c(c12)CCC3)c1ccco1 |
| InChI | InChI=1S/C15H14N4OS/c1-9(11-5-3-7-20-11)18-19-14-13-10-4-2-6-12(10)21-15(13)17-8-16-14/h3,5,7-8H,2,4,6H2,1H3,(H,16,17,19)/b18-9- |
| InChIKey | JAOGIGIFJHIANE-NVMNQCDNSA-N |
| XLogP | 3.61 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_F(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|