C18H18N4S — CID 58379466
N-[(Z)-(2-methylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 58379466) has the molecular formula C18H18N4S and a molecular weight of 322.44 g/mol. Its IUPAC name is N-[(Z)-(2-methylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(Z)-(2-methylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 58379466 |
| Molecular Formula | C18H18N4S |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[(Z)-(2-methylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccccc1/C=N\Nc1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H18N4S/c1-12-6-2-3-7-13(12)10-21-22-17-16-14-8-4-5-9-15(14)23-18(16)20-11-19-17/h2-3,6-7,10-11H,4-5,8-9H2,1H3,(H,19,20,22)/b21-10- |
| InChIKey | LDMLCPHBQJIQNW-FBHDLOMBSA-N |
| XLogP | 4.32 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|